C17H15FN4O — CID 168631348
2-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-4-(4-fluorophenyl)phenol (PubChem CID 168631348) has the molecular formula C17H15FN4O and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-4-(4-fluorophenyl)phenol.
| Compound Name | 2-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-4-(4-fluorophenyl)phenol |
|---|---|
| PubChem CID | 168631348 |
| Molecular Formula | C17H15FN4O |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-4-(4-fluorophenyl)phenol |
| SMILES | Cc1cn(N=Cc2cc(-c3ccc(F)cc3)ccc2O)c(N)n1 |
| InChI | InChI=1S/C17H15FN4O/c1-11-10-22(17(19)21-11)20-9-14-8-13(4-7-16(14)23)12-2-5-15(18)6-3-12/h2-10,23H,1H3,(H2,19,21) |
| InChIKey | BPQQUNGYYBWALV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|