C11H10Cl2N4O — CID 168630803
5-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2,4-dichlorophenol (PubChem CID 168630803) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 5-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2,4-dichlorophenol.
| Compound Name | 5-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2,4-dichlorophenol |
|---|---|
| PubChem CID | 168630803 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 5-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2,4-dichlorophenol |
| SMILES | Cc1cn(N=Cc2cc(O)c(Cl)cc2Cl)c(N)n1 |
| InChI | InChI=1S/C11H10Cl2N4O/c1-6-5-17(11(14)16-6)15-4-7-2-10(18)9(13)3-8(7)12/h2-5,18H,1H3,(H2,14,16) |
| InChIKey | NYMBVENTZWIPJA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|