C15H17ClN4O4 — CID 168630610
2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-5-chloro-2-ethoxyphenoxy]acetic acid (PubChem CID 168630610) has the molecular formula C15H17ClN4O4 and a molecular weight of 352.78 g/mol. Its IUPAC name is 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-5-chloro-2-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-5-chloro-2-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 168630610 |
| Molecular Formula | C15H17ClN4O4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-5-chloro-2-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(C=Nn2cc(C)nc2N)c(Cl)cc1OCC(=O)O |
| InChI | InChI=1S/C15H17ClN4O4/c1-3-23-12-4-10(6-18-20-7-9(2)19-15(20)17)11(16)5-13(12)24-8-14(21)22/h4-7H,3,8H2,1-2H3,(H2,17,19)(H,21,22) |
| InChIKey | YKHBILHCNFRALZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|