C18H20ClN3O6S — CID 168624712
2-[5-chloro-2-ethoxy-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 168624712) has the molecular formula C18H20ClN3O6S and a molecular weight of 441.89 g/mol. Its IUPAC name is 2-[5-chloro-2-ethoxy-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[5-chloro-2-ethoxy-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 168624712 |
| Molecular Formula | C18H20ClN3O6S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2-[5-chloro-2-ethoxy-4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(OCC)c(OCC(=O)O)cc2Cl)n1 |
| InChI | InChI=1S/C18H20ClN3O6S/c1-3-26-14-5-11(13(19)7-15(14)28-9-16(23)24)8-20-22-18-21-12(10-29-18)6-17(25)27-4-2/h5,7-8,10H,3-4,6,9H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | SDORIGQQJLIMLY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|