C16H16N4O7S — CID 168622919
2-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenoxy]acetic acid (PubChem CID 168622919) has the molecular formula C16H16N4O7S and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenoxy]acetic acid.
| Compound Name | 2-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenoxy]acetic acid |
|---|---|
| PubChem CID | 168622919 |
| Molecular Formula | C16H16N4O7S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenoxy]acetic acid |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc([N+](=O)[O-])ccc2OCC(=O)O)n1 |
| InChI | InChI=1S/C16H16N4O7S/c1-2-26-15(23)6-11-9-28-16(18-11)19-17-7-10-5-12(20(24)25)3-4-13(10)27-8-14(21)22/h3-5,7,9H,2,6,8H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | OHBLWSRPCJAIMK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 153.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|