C21H20N4O5S — CID 168625126
ethyl 2-[2-[2-[(3-nitro-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625126) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(3-nitro-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(3-nitro-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625126 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | ethyl 2-[2-[2-[(3-nitro-4-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OCc3ccccc3)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C21H20N4O5S/c1-2-29-20(26)11-17-14-31-21(23-17)24-22-12-16-8-9-19(18(10-16)25(27)28)30-13-15-6-4-3-5-7-15/h3-10,12,14H,2,11,13H2,1H3,(H,23,24) |
| InChIKey | PTFJPWYWDORDAT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|