C28H27N3O4S — CID 168622959
ethyl 2-[2-[2-[[2,5-bis(phenylmethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168622959) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2,5-bis(phenylmethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2,5-bis(phenylmethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168622959 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | ethyl 2-[2-[2-[[2,5-bis(phenylmethoxy)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(OCc3ccccc3)ccc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C28H27N3O4S/c1-2-33-27(32)16-24-20-36-28(30-24)31-29-17-23-15-25(34-18-21-9-5-3-6-10-21)13-14-26(23)35-19-22-11-7-4-8-12-22/h3-15,17,20H,2,16,18-19H2,1H3,(H,30,31) |
| InChIKey | BYAKPNAQFMQJGD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|