C23H24N4O4S — CID 168624380
ethyl 2-[2-[2-[[2-[2-(benzylamino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624380) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2-[2-(benzylamino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2-[2-(benzylamino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624380 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | ethyl 2-[2-[2-[[2-[2-(benzylamino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccccc2OCC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C23H24N4O4S/c1-2-30-22(29)12-19-16-32-23(26-19)27-25-14-18-10-6-7-11-20(18)31-15-21(28)24-13-17-8-4-3-5-9-17/h3-11,14,16H,2,12-13,15H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | HCSYNUHGRSWFLZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|