C22H28N4O4S — CID 168623761
ethyl 2-[2-[2-[[2-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623761) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623761 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | ethyl 2-[2-[2-[[2-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccccc2OCC(=O)N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C22H28N4O4S/c1-3-29-21(28)12-18-15-31-22(24-18)25-23-13-17-6-4-5-7-19(17)30-14-20(27)26-10-8-16(2)9-11-26/h4-7,13,15-16H,3,8-12,14H2,1-2H3,(H,24,25) |
| InChIKey | FXSHGDQPYZLUEO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|