C17H21N5O2S — CID 168627059
2-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-1-piperidin-1-ylethanone (PubChem CID 168627059) has the molecular formula C17H21N5O2S and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 168627059 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-1-piperidin-1-ylethanone |
| SMILES | Nc1csc(NN=Cc2ccccc2OCC(=O)N2CCCCC2)n1 |
| InChI | InChI=1S/C17H21N5O2S/c18-15-12-25-17(20-15)21-19-10-13-6-2-3-7-14(13)24-11-16(23)22-8-4-1-5-9-22/h2-3,6-7,10,12H,1,4-5,8-9,11,18H2,(H,20,21) |
| InChIKey | ILRNGXQRJIJGIU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|