C22H31N5O3S — CID 168624221
ethyl 2-[2-[2-[[2-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624221) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624221 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | ethyl 2-[2-[2-[[2-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccccc2OCCCN2CCN(C)CC2)n1 |
| InChI | InChI=1S/C22H31N5O3S/c1-3-29-21(28)15-19-17-31-22(24-19)25-23-16-18-7-4-5-8-20(18)30-14-6-9-27-12-10-26(2)11-13-27/h4-5,7-8,16-17H,3,6,9-15H2,1-2H3,(H,24,25) |
| InChIKey | VNVIEJBHWMZGMR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|