C23H32N4O3S — CID 168624097
ethyl 2-[2-[2-[[2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624097) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624097 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | ethyl 2-[2-[2-[[2-[2-(3,5-dimethylpiperidin-1-yl)ethoxy]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccccc2OCCN2CC(C)CC(C)C2)n1 |
| InChI | InChI=1S/C23H32N4O3S/c1-4-29-22(28)12-20-16-31-23(25-20)26-24-13-19-7-5-6-8-21(19)30-10-9-27-14-17(2)11-18(3)15-27/h5-8,13,16-18H,4,9-12,14-15H2,1-3H3,(H,25,26) |
| InChIKey | UXQXTOQSPZQSAQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|