C25H35N5O5S — CID 168624883
tert-butyl 4-[2-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]ethyl]piperazine-1-carboxylate (PubChem CID 168624883) has the molecular formula C25H35N5O5S and a molecular weight of 517.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168624883 |
| Molecular Formula | C25H35N5O5S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | tert-butyl 4-[2-[2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenoxy]ethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccccc2OCCN2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C25H35N5O5S/c1-5-33-22(31)16-20-18-36-23(27-20)28-26-17-19-8-6-7-9-21(19)34-15-14-29-10-12-30(13-11-29)24(32)35-25(2,3)4/h6-9,17-18H,5,10-16H2,1-4H3,(H,27,28) |
| InChIKey | XJARKOOVOSUOOB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|