C21H26N4O4S — CID 168623682
tert-butyl 4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-1,3-dihydroisoindole-2-carboxylate (PubChem CID 168623682) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is tert-butyl 4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 168623682 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | tert-butyl 4-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cccc3c2CN(C(=O)OC(C)(C)C)C3)n1 |
| InChI | InChI=1S/C21H26N4O4S/c1-5-28-18(26)9-16-13-30-19(23-16)24-22-10-14-7-6-8-15-11-25(12-17(14)15)20(27)29-21(2,3)4/h6-8,10,13H,5,9,11-12H2,1-4H3,(H,23,24) |
| InChIKey | LERVAJNVDAFABT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|