C17H21N3O2S2 — CID 168623104
ethyl 2-[2-[2-[(2-propylsulfanylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623104) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(2-propylsulfanylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(2-propylsulfanylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623104 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | ethyl 2-[2-[2-[(2-propylsulfanylphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCSc1ccccc1C=NNc1nc(CC(=O)OCC)cs1 |
| InChI | InChI=1S/C17H21N3O2S2/c1-3-9-23-15-8-6-5-7-13(15)11-18-20-17-19-14(12-24-17)10-16(21)22-4-2/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,19,20) |
| InChIKey | BXSHIHJLWAMWCC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|