C15H14FN3O4S — CID 168625408
2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-6-fluorobenzoic acid (PubChem CID 168625408) has the molecular formula C15H14FN3O4S and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-6-fluorobenzoic acid.
| Compound Name | 2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 168625408 |
| Molecular Formula | C15H14FN3O4S |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-6-fluorobenzoic acid |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cccc(F)c2C(=O)O)n1 |
| InChI | InChI=1S/C15H14FN3O4S/c1-2-23-12(20)6-10-8-24-15(18-10)19-17-7-9-4-3-5-11(16)13(9)14(21)22/h3-5,7-8H,2,6H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | GMMKQNWKLABLAN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|