C16H13F4N3O4S — CID 168625335
ethyl 2-[2-[2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625335) has the molecular formula C16H13F4N3O4S and a molecular weight of 419.36 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625335 |
| Molecular Formula | C16H13F4N3O4S |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | ethyl 2-[2-[2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cccc3c2OC(F)(F)C(F)(F)O3)n1 |
| InChI | InChI=1S/C16H13F4N3O4S/c1-2-25-12(24)6-10-8-28-14(22-10)23-21-7-9-4-3-5-11-13(9)27-16(19,20)15(17,18)26-11/h3-5,7-8H,2,6H2,1H3,(H,22,23) |
| InChIKey | IONQJDWWRVSXBM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|