C22H31N5O3S — CID 168618967
tert-butyl 4-[2-[3-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]ethyl]piperazine-1-carboxylate (PubChem CID 168618967) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168618967 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | tert-butyl 4-[2-[3-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]ethyl]piperazine-1-carboxylate |
| SMILES | Cc1csc(NN=Cc2cccc(OCCN3CCN(C(=O)OC(C)(C)C)CC3)c2)n1 |
| InChI | InChI=1S/C22H31N5O3S/c1-17-16-31-20(24-17)25-23-15-18-6-5-7-19(14-18)29-13-12-26-8-10-27(11-9-26)21(28)30-22(2,3)4/h5-7,14-16H,8-13H2,1-4H3,(H,24,25) |
| InChIKey | LMNRVOMJXMOQPK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|