C26H31N5O2S — CID 168577814
tert-butyl 4-[[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 168577814) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is tert-butyl 4-[[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168577814 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | tert-butyl 4-[[4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(C=NNc3nc(-c4ccccc4)cs3)cc2)CC1 |
| InChI | InChI=1S/C26H31N5O2S/c1-26(2,3)33-25(32)31-15-13-30(14-16-31)18-21-11-9-20(10-12-21)17-27-29-24-28-23(19-34-24)22-7-5-4-6-8-22/h4-12,17,19H,13-16,18H2,1-3H3,(H,28,29) |
| InChIKey | NWSHDHUPKNZHRT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|