C18H27N5O3 — CID 168533775
tert-butyl 4-[[4-[(carbamoylhydrazinylidene)methyl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 168533775) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(carbamoylhydrazinylidene)methyl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[(carbamoylhydrazinylidene)methyl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168533775 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | tert-butyl 4-[[4-[(carbamoylhydrazinylidene)methyl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(C=NNC(N)=O)cc2)CC1 |
| InChI | InChI=1S/C18H27N5O3/c1-18(2,3)26-17(25)23-10-8-22(9-11-23)13-15-6-4-14(5-7-15)12-20-21-16(19)24/h4-7,12H,8-11,13H2,1-3H3,(H3,19,21,24) |
| InChIKey | LNMZEHAFBDDZTM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|