C26H28N6O2S — CID 168577702
tert-butyl 4-[2-cyano-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 168577702) has the molecular formula C26H28N6O2S and a molecular weight of 488.62 g/mol. Its IUPAC name is tert-butyl 4-[2-cyano-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-cyano-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168577702 |
| Molecular Formula | C26H28N6O2S |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | tert-butyl 4-[2-cyano-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=NNc3nc(-c4ccccc4)cs3)cc2C#N)CC1 |
| InChI | InChI=1S/C26H28N6O2S/c1-26(2,3)34-25(33)32-13-11-31(12-14-32)23-10-9-19(15-21(23)16-27)17-28-30-24-29-22(18-35-24)20-7-5-4-6-8-20/h4-10,15,17-18H,11-14H2,1-3H3,(H,29,30) |
| InChIKey | QVBBWSIXRSFQQB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 93.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|