C25H30N6O2S — CID 168613617
tert-butyl 4-[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-cyanophenyl]piperazine-1-carboxylate (PubChem CID 168613617) has the molecular formula C25H30N6O2S and a molecular weight of 478.62 g/mol. Its IUPAC name is tert-butyl 4-[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-cyanophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-cyanophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168613617 |
| Molecular Formula | C25H30N6O2S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | tert-butyl 4-[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-cyanophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=NN=C(N)SCc3ccccc3)cc2C#N)CC1 |
| InChI | InChI=1S/C25H30N6O2S/c1-25(2,3)33-24(32)31-13-11-30(12-14-31)22-10-9-20(15-21(22)16-26)17-28-29-23(27)34-18-19-7-5-4-6-8-19/h4-10,15,17H,11-14,18H2,1-3H3,(H2,27,29) |
| InChIKey | UAGYHNZZIBRDBV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|