C16H12F2N4S — CID 168613156
benzyl N'-[(4-cyano-2,5-difluorophenyl)methylideneamino]carbamimidothioate (PubChem CID 168613156) has the molecular formula C16H12F2N4S and a molecular weight of 330.36 g/mol. Its IUPAC name is benzyl N'-[(4-cyano-2,5-difluorophenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(4-cyano-2,5-difluorophenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613156 |
| Molecular Formula | C16H12F2N4S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | benzyl N'-[(4-cyano-2,5-difluorophenyl)methylideneamino]carbamimidothioate |
| SMILES | N#Cc1cc(F)c(C=NN=C(N)SCc2ccccc2)cc1F |
| InChI | InChI=1S/C16H12F2N4S/c17-14-7-13(15(18)6-12(14)8-19)9-21-22-16(20)23-10-11-4-2-1-3-5-11/h1-7,9H,10H2,(H2,20,22) |
| InChIKey | HRCMTQCOEHSZHQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|