C16H15BrFN3S — CID 168613705
benzyl N'-[[2-(bromomethyl)-5-fluorophenyl]methylideneamino]carbamimidothioate (PubChem CID 168613705) has the molecular formula C16H15BrFN3S and a molecular weight of 380.29 g/mol. Its IUPAC name is benzyl N'-[[2-(bromomethyl)-5-fluorophenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[2-(bromomethyl)-5-fluorophenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613705 |
| Molecular Formula | C16H15BrFN3S |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | benzyl N'-[[2-(bromomethyl)-5-fluorophenyl]methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(F)ccc1CBr)SCc1ccccc1 |
| InChI | InChI=1S/C16H15BrFN3S/c17-9-13-6-7-15(18)8-14(13)10-20-21-16(19)22-11-12-4-2-1-3-5-12/h1-8,10H,9,11H2,(H2,19,21) |
| InChIKey | XNBAYHMCJYGZBB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|