C28H28N8O3 — CID 168571853
tert-butyl 4-[2-cyano-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl]piperazine-1-carboxylate (PubChem CID 168571853) has the molecular formula C28H28N8O3 and a molecular weight of 524.59 g/mol. Its IUPAC name is tert-butyl 4-[2-cyano-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-cyano-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168571853 |
| Molecular Formula | C28H28N8O3 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | tert-butyl 4-[2-cyano-4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=NNc3nc(-c4ccccc4)c(C#N)c(=O)[nH]3)cc2C#N)CC1 |
| InChI | InChI=1S/C28H28N8O3/c1-28(2,3)39-27(38)36-13-11-35(12-14-36)23-10-9-19(15-21(23)16-29)18-31-34-26-32-24(20-7-5-4-6-8-20)22(17-30)25(37)33-26/h4-10,15,18H,11-14H2,1-3H3,(H2,32,33,34,37) |
| InChIKey | QPUULOJUGCINQB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|