C24H25N7O — CID 168571942
2-[2-[[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168571942) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-[2-[[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168571942 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[2-[[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | CN1CCCN(c2ccc(C=NNc3nc(-c4ccccc4)c(C#N)c(=O)[nH]3)cc2)CC1 |
| InChI | InChI=1S/C24H25N7O/c1-30-12-5-13-31(15-14-30)20-10-8-18(9-11-20)17-26-29-24-27-22(19-6-3-2-4-7-19)21(16-25)23(32)28-24/h2-4,6-11,17H,5,12-15H2,1H3,(H2,27,28,29,32) |
| InChIKey | YTRFGHVEQSBGGZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|