C22H20Cl2N6O — CID 168570746
2-[2-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168570746) has the molecular formula C22H20Cl2N6O and a molecular weight of 455.35 g/mol. Its IUPAC name is 2-[2-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168570746 |
| Molecular Formula | C22H20Cl2N6O |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-[2-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(N(CCCl)CCCl)cc2)[nH]c1=O |
| InChI | InChI=1S/C22H20Cl2N6O/c23-10-12-30(13-11-24)18-8-6-16(7-9-18)15-26-29-22-27-20(17-4-2-1-3-5-17)19(14-25)21(31)28-22/h1-9,15H,10-13H2,(H2,27,28,29,31) |
| InChIKey | PRJGFAZCDWANMK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|