C20H13N7O2 — CID 168573393
2-[2-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168573393) has the molecular formula C20H13N7O2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-[2-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168573393 |
| Molecular Formula | C20H13N7O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[2-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(-c3ncon3)cc2)[nH]c1=O |
| InChI | InChI=1S/C20H13N7O2/c21-10-16-17(14-4-2-1-3-5-14)24-20(25-19(16)28)26-23-11-13-6-8-15(9-7-13)18-22-12-29-27-18/h1-9,11-12H,(H2,24,25,26,28) |
| InChIKey | KCDXJFRTTNEIKD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 132.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|