C24H15N7O — CID 168573550
6-oxo-4-phenyl-2-[2-[[4-(2-pyrimidin-5-ylethynyl)phenyl]methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 168573550) has the molecular formula C24H15N7O and a molecular weight of 417.43 g/mol. Its IUPAC name is 6-oxo-4-phenyl-2-[2-[[4-(2-pyrimidin-5-ylethynyl)phenyl]methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-oxo-4-phenyl-2-[2-[[4-(2-pyrimidin-5-ylethynyl)phenyl]methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168573550 |
| Molecular Formula | C24H15N7O |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 6-oxo-4-phenyl-2-[2-[[4-(2-pyrimidin-5-ylethynyl)phenyl]methylidene]hydrazinyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(C#Cc3cncnc3)cc2)[nH]c1=O |
| InChI | InChI=1S/C24H15N7O/c25-12-21-22(20-4-2-1-3-5-20)29-24(30-23(21)32)31-28-15-18-9-6-17(7-10-18)8-11-19-13-26-16-27-14-19/h1-7,9-10,13-16H,(H2,29,30,31,32) |
| InChIKey | KQEHVAWQUZQZFR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|