C29H27N7O — CID 168572039
2-[2-[[4-(4-benzylpiperazin-1-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile (PubChem CID 168572039) has the molecular formula C29H27N7O and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-[2-[[4-(4-benzylpiperazin-1-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-[2-[[4-(4-benzylpiperazin-1-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168572039 |
| Molecular Formula | C29H27N7O |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-[2-[[4-(4-benzylpiperazin-1-yl)phenyl]methylidene]hydrazinyl]-6-oxo-4-phenyl-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)[nH]c1=O |
| InChI | InChI=1S/C29H27N7O/c30-19-26-27(24-9-5-2-6-10-24)32-29(33-28(26)37)34-31-20-22-11-13-25(14-12-22)36-17-15-35(16-18-36)21-23-7-3-1-4-8-23/h1-14,20H,15-18,21H2,(H2,32,33,34,37) |
| InChIKey | RHTNEAIAQSZZIA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|