C19H22N6O2S — CID 168628201
ethyl 1-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-cyanophenyl]piperidine-4-carboxylate (PubChem CID 168628201) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is ethyl 1-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-cyanophenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-cyanophenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 168628201 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl 1-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-cyanophenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(C=NNc3nc(N)cs3)cc2C#N)CC1 |
| InChI | InChI=1S/C19H22N6O2S/c1-2-27-18(26)14-5-7-25(8-6-14)16-4-3-13(9-15(16)10-20)11-22-24-19-23-17(21)12-28-19/h3-4,9,11-12,14H,2,5-8,21H2,1H3,(H,23,24) |
| InChIKey | ZNCBSCRWEQRMRC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|