C15H19N3O2 — CID 22227900
ethyl 1-(4-amino-2-cyanophenyl)piperidine-4-carboxylate (PubChem CID 22227900) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is ethyl 1-(4-amino-2-cyanophenyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(4-amino-2-cyanophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 22227900 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | ethyl 1-(4-amino-2-cyanophenyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(N)cc2C#N)CC1 |
| InChI | InChI=1S/C15H19N3O2/c1-2-20-15(19)11-5-7-18(8-6-11)14-4-3-13(17)9-12(14)10-16/h3-4,9,11H,2,5-8,17H2,1H3 |
| InChIKey | KIUALFDOCCZYMV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|