C14H20N2O2 — CID 22060555
ethyl 1-(3-aminophenyl)piperidine-4-carboxylate (PubChem CID 22060555) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is ethyl 1-(3-aminophenyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-aminophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 22060555 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | ethyl 1-(3-aminophenyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cccc(N)c2)CC1 |
| InChI | InChI=1S/C14H20N2O2/c1-2-18-14(17)11-6-8-16(9-7-11)13-5-3-4-12(15)10-13/h3-5,10-11H,2,6-9,15H2,1H3 |
| InChIKey | OVGSXCLWZBODGA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|