C22H22F3NO3 — CID 59493152
ethyl 1-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]piperidine-4-carboxylate (PubChem CID 59493152) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is ethyl 1-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 59493152 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | ethyl 1-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc3c(c2)C(O)(C(F)(F)F)c2ccccc2-3)CC1 |
| InChI | InChI=1S/C22H22F3NO3/c1-2-29-20(27)14-9-11-26(12-10-14)15-7-8-17-16-5-3-4-6-18(16)21(28,19(17)13-15)22(23,24)25/h3-8,13-14,28H,2,9-12H2,1H3 |
| InChIKey | PLHOPPBTVYGGST-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |