C21H21F3O4 — CID 59492500
ethyl 5-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxypentanoate (PubChem CID 59492500) has the molecular formula C21H21F3O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is ethyl 5-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxypentanoate.
| Compound Name | ethyl 5-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 59492500 |
| Molecular Formula | C21H21F3O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | ethyl 5-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxypentanoate |
| SMILES | CCOC(=O)CCCCOc1ccc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C21H21F3O4/c1-2-27-19(25)9-5-6-12-28-14-10-11-16-15-7-3-4-8-17(15)20(26,18(16)13-14)21(22,23)24/h3-4,7-8,10-11,13,26H,2,5-6,9,12H2,1H3 |
| InChIKey | ABBKCQLEJBSUDQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|