C19H18F3NO4 — CID 59492579
2-[2-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl-methylamino]acetic acid (PubChem CID 59492579) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2-[2-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl-methylamino]acetic acid.
| Compound Name | 2-[2-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 59492579 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[2-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl-methylamino]acetic acid |
| SMILES | CN(CCOc1ccc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2)CC(=O)O |
| InChI | InChI=1S/C19H18F3NO4/c1-23(11-17(24)25)8-9-27-12-6-7-14-13-4-2-3-5-15(13)18(26,16(14)10-12)19(20,21)22/h2-7,10,26H,8-9,11H2,1H3,(H,24,25) |
| InChIKey | XGAWTIQKVPQRKG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |