C22H23F3N2O5 — CID 143972424
3-[2-[4-carbamoyl-9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl-methylamino]propyl formate (PubChem CID 143972424) has the molecular formula C22H23F3N2O5 and a molecular weight of 452.43 g/mol. Its IUPAC name is 3-[2-[4-carbamoyl-9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl-methylamino]propyl formate.
| Compound Name | 3-[2-[4-carbamoyl-9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl-methylamino]propyl formate |
|---|---|
| PubChem CID | 143972424 |
| Molecular Formula | C22H23F3N2O5 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 3-[2-[4-carbamoyl-9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]oxyethyl-methylamino]propyl formate |
| SMILES | CN(CCCOC=O)CCOc1cc(C(N)=O)c2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C22H23F3N2O5/c1-27(7-4-9-31-13-28)8-10-32-14-11-16(20(26)29)19-15-5-2-3-6-17(15)21(30,18(19)12-14)22(23,24)25/h2-3,5-6,11-13,30H,4,7-10H2,1H3,(H2,26,29) |
| InChIKey | SDODJNOPAAVGAG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|