C19H19F2O4P — CID 143972678
5-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]oxypentanoic acid (PubChem CID 143972678) has the molecular formula C19H19F2O4P and a molecular weight of 380.33 g/mol. Its IUPAC name is 5-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]oxypentanoic acid.
| Compound Name | 5-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]oxypentanoic acid |
|---|---|
| PubChem CID | 143972678 |
| Molecular Formula | C19H19F2O4P |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 5-[9-[difluoro(phosphanyl)methyl]-9-hydroxyfluoren-2-yl]oxypentanoic acid |
| SMILES | O=C(O)CCCCOc1ccc2c(c1)C(O)(C(F)(F)P)c1ccccc1-2 |
| InChI | InChI=1S/C19H19F2O4P/c20-19(21,26)18(24)15-6-2-1-5-13(15)14-9-8-12(11-16(14)18)25-10-4-3-7-17(22)23/h1-2,5-6,8-9,11,24H,3-4,7,10,26H2,(H,22,23) |
| InChIKey | OGHJJFGBRDJROQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|