C22H18F2NO2P — CID 143972688
9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-methyl-N-phenylfluorene-2-carboxamide (PubChem CID 143972688) has the molecular formula C22H18F2NO2P and a molecular weight of 397.36 g/mol. Its IUPAC name is 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-methyl-N-phenylfluorene-2-carboxamide.
| Compound Name | 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-methyl-N-phenylfluorene-2-carboxamide |
|---|---|
| PubChem CID | 143972688 |
| Molecular Formula | C22H18F2NO2P |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-methyl-N-phenylfluorene-2-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)C(O)(C(F)(F)P)c1ccccc1-2)c1ccccc1 |
| InChI | InChI=1S/C22H18F2NO2P/c1-25(15-7-3-2-4-8-15)20(26)14-11-12-17-16-9-5-6-10-18(16)21(27,19(17)13-14)22(23,24)28/h2-13,27H,28H2,1H3 |
| InChIKey | OBEISDBLDMBVBV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|