C22H20F2N3O3P — CID 143972598
9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-(2-hydroxyethyl)-N-methyl-4-pyrimidin-5-ylfluorene-2-carboxamide (PubChem CID 143972598) has the molecular formula C22H20F2N3O3P and a molecular weight of 443.39 g/mol. Its IUPAC name is 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-(2-hydroxyethyl)-N-methyl-4-pyrimidin-5-ylfluorene-2-carboxamide.
| Compound Name | 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-(2-hydroxyethyl)-N-methyl-4-pyrimidin-5-ylfluorene-2-carboxamide |
|---|---|
| PubChem CID | 143972598 |
| Molecular Formula | C22H20F2N3O3P |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-(2-hydroxyethyl)-N-methyl-4-pyrimidin-5-ylfluorene-2-carboxamide |
| SMILES | CN(CCO)C(=O)c1cc(-c2cncnc2)c2c(c1)C(O)(C(F)(F)P)c1ccccc1-2 |
| InChI | InChI=1S/C22H20F2N3O3P/c1-27(6-7-28)20(29)13-8-16(14-10-25-12-26-11-14)19-15-4-2-3-5-17(15)21(30,18(19)9-13)22(23,24)31/h2-5,8-12,28,30H,6-7,31H2,1H3 |
| InChIKey | ZSLBRUVQRXHYLZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|