C19H20F2NO3P — CID 143972470
9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-(3-hydroxypropyl)-N-methylfluorene-2-carboxamide (PubChem CID 143972470) has the molecular formula C19H20F2NO3P and a molecular weight of 379.34 g/mol. Its IUPAC name is 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-(3-hydroxypropyl)-N-methylfluorene-2-carboxamide.
| Compound Name | 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-(3-hydroxypropyl)-N-methylfluorene-2-carboxamide |
|---|---|
| PubChem CID | 143972470 |
| Molecular Formula | C19H20F2NO3P |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 9-[difluoro(phosphanyl)methyl]-9-hydroxy-N-(3-hydroxypropyl)-N-methylfluorene-2-carboxamide |
| SMILES | CN(CCCO)C(=O)c1ccc2c(c1)C(O)(C(F)(F)P)c1ccccc1-2 |
| InChI | InChI=1S/C19H20F2NO3P/c1-22(9-4-10-23)17(24)12-7-8-14-13-5-2-3-6-15(13)18(25,16(14)11-12)19(20,21)26/h2-3,5-8,11,23,25H,4,9-10,26H2,1H3 |
| InChIKey | AKIZMDHJYNWRHF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|