C14H20N2O2S — CID 107199741
3-carbamothioyl-N-(5-hydroxypentyl)-N-methylbenzamide (PubChem CID 107199741) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-carbamothioyl-N-(5-hydroxypentyl)-N-methylbenzamide.
| Compound Name | 3-carbamothioyl-N-(5-hydroxypentyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 107199741 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-carbamothioyl-N-(5-hydroxypentyl)-N-methylbenzamide |
| SMILES | CN(CCCCCO)C(=O)c1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C14H20N2O2S/c1-16(8-3-2-4-9-17)14(18)12-7-5-6-11(10-12)13(15)19/h5-7,10,17H,2-4,8-9H2,1H3,(H2,15,19) |
| InChIKey | NDTSXXFFMFJGLD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|