C12H17FN2O2 — CID 107199083
2-fluoro-N-(5-hydroxypentyl)-N-methylpyridine-4-carboxamide (PubChem CID 107199083) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-fluoro-N-(5-hydroxypentyl)-N-methylpyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-(5-hydroxypentyl)-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 107199083 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-fluoro-N-(5-hydroxypentyl)-N-methylpyridine-4-carboxamide |
| SMILES | CN(CCCCCO)C(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C12H17FN2O2/c1-15(7-3-2-4-8-16)12(17)10-5-6-14-11(13)9-10/h5-6,9,16H,2-4,7-8H2,1H3 |
| InChIKey | IWCSJRZYSHOUCN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|