C13H16F3NO2 — CID 107202076
2,4,6-trifluoro-N-(5-hydroxypentyl)-N-methylbenzamide (PubChem CID 107202076) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-(5-hydroxypentyl)-N-methylbenzamide.
| Compound Name | 2,4,6-trifluoro-N-(5-hydroxypentyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 107202076 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2,4,6-trifluoro-N-(5-hydroxypentyl)-N-methylbenzamide |
| SMILES | CN(CCCCCO)C(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H16F3NO2/c1-17(5-3-2-4-6-18)13(19)12-10(15)7-9(14)8-11(12)16/h7-8,18H,2-6H2,1H3 |
| InChIKey | SEKXBZDNCDWCLM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|