C11H9F3N2O — CID 65098629
N-(2-cyanoethyl)-2,4,6-trifluoro-N-methylbenzamide (PubChem CID 65098629) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2,4,6-trifluoro-N-methylbenzamide.
| Compound Name | N-(2-cyanoethyl)-2,4,6-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 65098629 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-(2-cyanoethyl)-2,4,6-trifluoro-N-methylbenzamide |
| SMILES | CN(CCC#N)C(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H9F3N2O/c1-16(4-2-3-15)11(17)10-8(13)5-7(12)6-9(10)14/h5-6H,2,4H2,1H3 |
| InChIKey | JGNPMKKQBYVXGU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |