C13H16N2O — CID 2215664
N-(2-cyanoethyl)-N,3,4-trimethylbenzamide (PubChem CID 2215664) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N,3,4-trimethylbenzamide.
| Compound Name | N-(2-cyanoethyl)-N,3,4-trimethylbenzamide |
|---|---|
| PubChem CID | 2215664 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(2-cyanoethyl)-N,3,4-trimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)CCC#N)cc1C |
| InChI | InChI=1S/C13H16N2O/c1-10-5-6-12(9-11(10)2)13(16)15(3)8-4-7-14/h5-6,9H,4,8H2,1-3H3 |
| InChIKey | OLKAYEPTVDKWKX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |