C13H15NO — CID 82076500
5-(3,4-dimethylphenyl)-5-oxopentanenitrile (PubChem CID 82076500) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-5-oxopentanenitrile.
| Compound Name | 5-(3,4-dimethylphenyl)-5-oxopentanenitrile |
|---|---|
| PubChem CID | 82076500 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-5-oxopentanenitrile |
| SMILES | Cc1ccc(C(=O)CCCC#N)cc1C |
| InChI | InChI=1S/C13H15NO/c1-10-6-7-12(9-11(10)2)13(15)5-3-4-8-14/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | HLIOGPQPHFZQBD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|