C12H17NO — CID 55267484
4-amino-1-(3,4-dimethylphenyl)butan-1-one (PubChem CID 55267484) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-amino-1-(3,4-dimethylphenyl)butan-1-one.
| Compound Name | 4-amino-1-(3,4-dimethylphenyl)butan-1-one |
|---|---|
| PubChem CID | 55267484 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-amino-1-(3,4-dimethylphenyl)butan-1-one |
| SMILES | Cc1ccc(C(=O)CCCN)cc1C |
| InChI | InChI=1S/C12H17NO/c1-9-5-6-11(8-10(9)2)12(14)4-3-7-13/h5-6,8H,3-4,7,13H2,1-2H3 |
| InChIKey | VSOGFRNHKODYDP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |