C15H23NO — CID 116581624
6-amino-1-(3,4-dimethylphenyl)-4-methylhexan-1-one (PubChem CID 116581624) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 6-amino-1-(3,4-dimethylphenyl)-4-methylhexan-1-one.
| Compound Name | 6-amino-1-(3,4-dimethylphenyl)-4-methylhexan-1-one |
|---|---|
| PubChem CID | 116581624 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 6-amino-1-(3,4-dimethylphenyl)-4-methylhexan-1-one |
| SMILES | Cc1ccc(C(=O)CCC(C)CCN)cc1C |
| InChI | InChI=1S/C15H23NO/c1-11(8-9-16)4-7-15(17)14-6-5-12(2)13(3)10-14/h5-6,10-11H,4,7-9,16H2,1-3H3 |
| InChIKey | FWKQRDPQZYSCJB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |