C22H36O — CID 146006499
1-(3,4-dimethylphenyl)tetradecan-1-one (PubChem CID 146006499) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)tetradecan-1-one.
| Compound Name | 1-(3,4-dimethylphenyl)tetradecan-1-one |
|---|---|
| PubChem CID | 146006499 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 1-(3,4-dimethylphenyl)tetradecan-1-one |
| SMILES | CCCCCCCCCCCCCC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H36O/c1-4-5-6-7-8-9-10-11-12-13-14-15-22(23)21-17-16-19(2)20(3)18-21/h16-18H,4-15H2,1-3H3 |
| InChIKey | NSLNNERGGULFNO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|